cas: 54231-33-3 — see every product listed under this CAS number, including other names
3-Bromo-2-nitropyridine 98% (CAS 54231-33-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139378-250mg |
| cas | 54231-33-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 509.44 Pln | |
| Ambeed | 100g | 1722.06 Pln | |
| Ambeed | 500g | 6667.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A139378 |
3-bromo-2-nitropyridine (CAS 54231-33-3) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 3-bromo-2-nitropyridine. InChIKey: WFNISJZUJCKTLT-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 3-bromo-2-nitropyridine |
| InChIKey | WFNISJZUJCKTLT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)