CAS 89364-04-5 appears in our catalog under these names: 3-Bromo-4-nitropyridine 95%, 3-Bromo-4-nitropyridine, 95%, 95%, 3-Bromo-4-nitropyridine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
3-bromo-4-nitropyridine (CAS 89364-04-5) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 3-bromo-4-nitropyridine. InChIKey: CJEWCWSWUUFORD-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 3-bromo-4-nitropyridine |
| InChIKey | CJEWCWSWUUFORD-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)