CAS 4487-59-6 appears in our catalog under these names: 2-Bromo-5-nitropyridine, 2-Bromo-5-nitropyridine, 98%, 2-Bromo-5-nitropyridine, >98.0%(GC), 2-Bromo-5-nitropyridine 98%, 2-Bromo-5-nitropyridine, 99.85%. Offered by: TRC, Thermo Scientific (Acros), TCI, Ambeed, MedChemExpress. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 500g, 1000g, 25 g.
2-bromo-5-nitropyridine (CAS 4487-59-6) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 2-bromo-5-nitropyridine. InChIKey: HUUFTVUBFFESEN-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 2-bromo-5-nitropyridine |
| InChIKey | HUUFTVUBFFESEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)