CAS 54231-33-3 appears in our catalog under these names: 3–Bromo–2–nitropyridine, 3-Bromo-2-nitropyridine, 98+% , 3-Bromo-2-nitropyridine 98%, 3-Bromo-2-nitropyridine, 97%, 3-Bromo-2-nitropyridine, >98.0%(GC). Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem, TCI. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g, 500g.
3-bromo-2-nitropyridine (CAS 54231-33-3) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 3-bromo-2-nitropyridine. InChIKey: WFNISJZUJCKTLT-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 3-bromo-2-nitropyridine |
| InChIKey | WFNISJZUJCKTLT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)