CAS 19755-53-4 appears in our catalog under these names: 2–Bromo–3–nitropyridine, 2-Bromo-3-nitropyridine, 98% , 2-Bromo-3-nitropyridine, >98.0%(GC), 2-Bromo-3-nitropyridine 97%, 2-Bromo-3-nitropyridine, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 1g, 5g, 500g, 10g.
2-bromo-3-nitropyridine (CAS 19755-53-4) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 2-bromo-3-nitropyridine. InChIKey: ZCCUFLITCDHRMG-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 2-bromo-3-nitropyridine |
| InChIKey | ZCCUFLITCDHRMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)