CAS 15862-30-3 appears in our catalog under these names: 3-Bromo-5-nitropyridine 98%, 3-Bromo-5-nitropyridine, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500mg.
3-bromo-5-nitropyridine (CAS 15862-30-3) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 3-bromo-5-nitropyridine. InChIKey: WHYJVHQKKJHXTB-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 3-bromo-5-nitropyridine |
| InChIKey | WHYJVHQKKJHXTB-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)