CAS 1695767-14-6 is the registry number for 8-Bromo-1,5-dichloroisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-1,5-dichloroisoquinoline (CAS 1695767-14-6) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 8-bromo-1,5-dichloroisoquinoline. InChIKey: WUNBAMGUUNISQZ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 8-bromo-1,5-dichloroisoquinoline |
| InChIKey | WUNBAMGUUNISQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C=CN=C2Cl)Br |
Computed by PubChem (NCBI)