3-Bromo-4-(trifluoromethyl)benzoic acid 95%
cas: 581813-17-4 — see every product listed under this CAS number, including other names
3-Bromo-4-(trifluoromethyl)benzoic acid 95% (CAS 581813-17-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A330850-250mg |
| cas | 581813-17-4 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 298.06 Pln | |
| Ambeed | 10g | 515.00 Pln | |
| Ambeed | 25g | 1165.81 Pln | |
| Ambeed | 100g | 4291.94 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A330850 |
3-bromo-4-(trifluoromethyl)benzoic acid (CAS 581813-17-4) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 3-bromo-4-(trifluoromethyl)benzoic acid. InChIKey: OWNPWXHFRGDHMC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 3-bromo-4-(trifluoromethyl)benzoic acid |
| InChIKey | OWNPWXHFRGDHMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)