cas: 581813-17-4 — see every product listed under this CAS number, including other names
3-Bromo-4-(trifluoromethyl)benzoic acid, 95%, 95% (CAS 581813-17-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J26-250mg |
| cas | 581813-17-4 |
| size | 250mg |
| availability | 179.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 395.60 Pln | |
| Chemat | 25g | 899.60 Pln | |
| Chemat | 50g | 1691.60 Pln | |
| Chemat | 100g | 3227.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-(trifluoromethyl)benzoic acid (CAS 581813-17-4) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 3-bromo-4-(trifluoromethyl)benzoic acid. InChIKey: OWNPWXHFRGDHMC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 3-bromo-4-(trifluoromethyl)benzoic acid |
| InChIKey | OWNPWXHFRGDHMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)