cas: 101420-81-9 — see every product listed under this CAS number, including other names
3-Bromo-4-nitrobenzoic Acid, >98.0%(GC)(T) (CAS 101420-81-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4786-1G |
| cas | 101420-81-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 270.78 Pln | |
| TCI | 5g | 831.35 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
3-bromo-4-nitrobenzoic acid (CAS 101420-81-9) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 3-bromo-4-nitrobenzoic acid. InChIKey: KKPPNEJUUOQRLE-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 3-bromo-4-nitrobenzoic acid |
| InChIKey | KKPPNEJUUOQRLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)