cas: 101420-81-9 — see every product listed under this CAS number, including other names
3-Bromo-4-nitrobenzoic acid, 97%, 97% (CAS 101420-81-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1115H2-250mg |
| cas | 101420-81-9 |
| size | 250mg |
| availability | 19g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 10g | 381.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-nitrobenzoic acid (CAS 101420-81-9) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 3-bromo-4-nitrobenzoic acid. InChIKey: KKPPNEJUUOQRLE-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 3-bromo-4-nitrobenzoic acid |
| InChIKey | KKPPNEJUUOQRLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)