cas: 89364-04-5 — see every product listed under this CAS number, including other names
3-Bromo-4-nitropyridine, 95%, 95% (CAS 89364-04-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144MC-100mg |
| cas | 89364-04-5 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 218.00 Pln | |
| Chemat | 25g | 453.20 Pln | |
| Chemat | 100g | 1629.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-nitropyridine (CAS 89364-04-5) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 3-bromo-4-nitropyridine. InChIKey: CJEWCWSWUUFORD-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 3-bromo-4-nitropyridine |
| InChIKey | CJEWCWSWUUFORD-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)