cas: 886498-07-3 — see every product listed under this CAS number, including other names
3-Bromo-5-(trifluoromethoxy)benzaldehyde 95% (CAS 886498-07-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A386754-5g |
| cas | 886498-07-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 10g | 592.88 Pln | |
| Ambeed | 25g | 1232.56 Pln | |
| Ambeed | 100g | 3813.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A386754 |
3-bromo-5-(trifluoromethoxy)benzaldehyde (CAS 886498-07-3) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 3-bromo-5-(trifluoromethoxy)benzaldehyde. InChIKey: ALIVUZVZCLVJQN-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | ALIVUZVZCLVJQN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Br)C=O |
Computed by PubChem (NCBI)