cas: 116632-23-6 — see every product listed under this CAS number, including other names
3-Bromo-5-nitrophenol 95% (CAS 116632-23-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A247766-250mg |
| cas | 116632-23-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 398.19 Pln | |
| Ambeed | 25g | 765.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A247766 |
3-bromo-5-nitrophenol (CAS 116632-23-6) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 3-bromo-5-nitrophenol. InChIKey: VJQGLUHOAIZTNK-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 3-bromo-5-nitrophenol |
| InChIKey | VJQGLUHOAIZTNK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)