cas: 116632-23-6 — see every product listed under this CAS number, including other names
3-Bromo-5-nitrophenol, 98%, 98% (CAS 116632-23-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111CXB-100mg |
| cas | 116632-23-6 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 25g | 544.40 Pln | |
| Chemat | 50g | 957.20 Pln | |
| Chemat | 100g | 1715.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-nitrophenol (CAS 116632-23-6) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 3-bromo-5-nitrophenol. InChIKey: VJQGLUHOAIZTNK-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 3-bromo-5-nitrophenol |
| InChIKey | VJQGLUHOAIZTNK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)