3-Chloro-4-formylbenzoic acid, 98%
cas: 58588-59-3 — see every product listed under this CAS number, including other names
3-Chloro-4-formylbenzoic acid, 98% (CAS 58588-59-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A618817-250mg |
| cas | 58588-59-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 604.00 Pln | |
| Ambeed | 1g | 1215.88 Pln | |
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 1446.80 Pln | |
| Chemat | 5g | 2536.40 Pln | |
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 607.10 Pln | |
| Fluorochem | 1g | 1205.84 Pln | |
| Fluorochem | 5g | 2611.60 Pln | |
| Fluorochem | 10g | 4449.49 Pln | |
| BLDpharm | 100mg | 414.32 Pln | |
| BLDpharm | 250mg | 647.57 Pln | |
| BLDpharm | 1g | 1891.58 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-chloro-4-formylbenzoic acid (CAS 58588-59-3) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 3-chloro-4-formylbenzoic acid. InChIKey: STTXUSSNIZOQGV-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 3-chloro-4-formylbenzoic acid |
| InChIKey | STTXUSSNIZOQGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)C=O |
Computed by PubChem (NCBI)