cas: 433926-48-8 — see every product listed under this CAS number, including other names
3-Chloro-5-(trifluoromethoxy)benzaldehyde, 97% (CAS 433926-48-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238679-1G |
| cas | 433926-48-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 450.90 Pln | |
| Fluorochem | 25g | 1028.82 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-chloro-5-(trifluoromethoxy)benzaldehyde (CAS 433926-48-8) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 3-chloro-5-(trifluoromethoxy)benzaldehyde. InChIKey: LWQSWEYYGGFLDR-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | LWQSWEYYGGFLDR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Cl)C=O |
Computed by PubChem (NCBI)