cas: 433926-48-8 — see every product listed under this CAS number, including other names
3-Chloro-5-(trifluoromethoxy)benzaldehyde, 98%, 98% (CAS 433926-48-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DFJA-250mg |
| cas | 433926-48-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 434.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-chloro-5-(trifluoromethoxy)benzaldehyde (CAS 433926-48-8) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 3-chloro-5-(trifluoromethoxy)benzaldehyde. InChIKey: LWQSWEYYGGFLDR-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | LWQSWEYYGGFLDR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Cl)C=O |
Computed by PubChem (NCBI)