3-Chloro-5-(trifluoromethoxy)benzoic acid, 97%
cas: 433926-46-6 — see every product listed under this CAS number, including other names
3-Chloro-5-(trifluoromethoxy)benzoic acid, 97% (CAS 433926-46-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A504085-250mg |
| cas | 433926-46-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 426.00 Pln | |
| Ambeed | 25g | 1544.06 Pln | |
| Ambeed | 100g | 4508.88 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 181.07 Pln | |
| BLDpharm | 5g | 453.20 Pln | |
| BLDpharm | 25g | 1663.88 Pln | |
| BLDpharm | 100g | 4857.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-chloro-5-(trifluoromethoxy)benzoic acid (CAS 433926-46-6) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: 3-chloro-5-(trifluoromethoxy)benzoic acid. InChIKey: KVXQRRFQLRUCKN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethoxy)benzoic acid |
| InChIKey | KVXQRRFQLRUCKN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)