3-Chloro-5-(trifluoromethoxy)benzoic acid, 98%
cas: 433926-46-6 — see every product listed under this CAS number, including other names
3-Chloro-5-(trifluoromethoxy)benzoic acid, 98% (CAS 433926-46-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg, 50g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F334659-1G |
| cas | 433926-46-6 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 10g | 820.56 Pln | |
| Fluorochem | 25g | 1601.54 Pln | |
| Fluorochem | 100g | 4610.89 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 501.20 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 50g | 1571.60 Pln | |
| Chemat | 100g | 2790.80 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
3-chloro-5-(trifluoromethoxy)benzoic acid (CAS 433926-46-6) is a chemical compound with the molecular formula C8H4ClF3O3 and a molecular weight of 240.56 g/mol. IUPAC name: 3-chloro-5-(trifluoromethoxy)benzoic acid. InChIKey: KVXQRRFQLRUCKN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O3 |
|---|---|
| Molecular weight | 240.56 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethoxy)benzoic acid |
| InChIKey | KVXQRRFQLRUCKN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)