cas: 219519-77-4 — see every product listed under this CAS number, including other names
3-Cyano-2-fluorobenzoic acid, 95% (CAS 219519-77-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221472-250MG |
| cas | 219519-77-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 752.88 Pln | |
| Fluorochem | 10g | 1445.34 Pln | |
| Fluorochem | 25g | 2262.76 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-cyano-2-fluorobenzoic acid (CAS 219519-77-4) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 3-cyano-2-fluorobenzoic acid. InChIKey: MTYFJFMXUMMQDL-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 3-cyano-2-fluorobenzoic acid |
| InChIKey | MTYFJFMXUMMQDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)F)C#N |
Computed by PubChem (NCBI)