CAS 176508-81-9 appears in our catalog under these names: 4-cyano-3-fluorobenzoic acid, 95%, 4–Cyano–3–fluorobenzoic acid, 4-Cyano-3-fluorobenzoic Acid, >97.0%(HPLC)(T), 4-Cyano-3-fluorobenzoic acid 98% HPLC, 4-CYANO-3-FLUOROBENZOIC ACID. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 500g.
4-cyano-3-fluorobenzoic acid (CAS 176508-81-9) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 4-cyano-3-fluorobenzoic acid. InChIKey: ZWKNDLMYSLLMRF-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 4-cyano-3-fluorobenzoic acid |
| InChIKey | ZWKNDLMYSLLMRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)F)C#N |
Computed by PubChem (NCBI)