Products 219519-77-4
CAS 219519-77-4 appears in our catalog under these names: 3-Cyano-2-fluorobenzoic acid, 98%, 3–Cyano–2–fluorobenzoic acid, 3-Cyano-2-fluorobenzoic acid 97%, 3-Cyano-2-fluorobenzoic Acid, 97%, 97%, 3-Cyano-2-fluorobenzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 1g, 250mg, 100mg.
3-cyano-2-fluorobenzoic acid (CAS 219519-77-4) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 3-cyano-2-fluorobenzoic acid. InChIKey: MTYFJFMXUMMQDL-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 3-cyano-2-fluorobenzoic acid |
| InChIKey | MTYFJFMXUMMQDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)F)C#N |
Computed by PubChem (NCBI)