CAS 324-03-8 appears in our catalog under these names: 6-Fluoroisatin, 95%, 6-Fluoroisatin, 6–Fluoroisatin, 6-Fluoroisatin 97%, 6-FLUOROISATIN, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 250mg, 10g, 500g.
6-fluoro-1H-indole-2,3-dione (CAS 324-03-8) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 6-fluoro-1H-indole-2,3-dione. InChIKey: CWVFOAVBTUHQCZ-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 6-fluoro-1H-indole-2,3-dione |
| InChIKey | CWVFOAVBTUHQCZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)C2=O |
Computed by PubChem (NCBI)