Products 887266-96-8
CAS 887266-96-8 appears in our catalog under these names: 2-Cyano-6-fluorobenzoic acid, 95%, 2-Cyano-6-fluorobenzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 25g.
2-cyano-6-fluorobenzoic acid (CAS 887266-96-8) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 2-cyano-6-fluorobenzoic acid. InChIKey: KBJBENDDHRHXIK-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 2-cyano-6-fluorobenzoic acid |
| InChIKey | KBJBENDDHRHXIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)O)C#N |
Computed by PubChem (NCBI)