CAS 346-34-9 appears in our catalog under these names: 4-Fluoroindoline-2,3-dione, 97%, 4-Fluoroindoline-2,3-dione, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 25g.
4-fluoro-1H-indole-2,3-dione (CAS 346-34-9) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 4-fluoro-1H-indole-2,3-dione. InChIKey: VUPIFURSDLGPMH-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 4-fluoro-1H-indole-2,3-dione |
| InChIKey | VUPIFURSDLGPMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)