Products 1214379-33-5
CAS 1214379-33-5 appears in our catalog under these names: 2-Cyano-3-fluorobenzoic acid, 95%, 2-Cyano-3-fluorobenzoic acid, 2-Cyano-3-fluorobenzoic acid 95%, 2-Cyano-3-fluorobenzoic acid, 95%, 95%, 2-Cyano-3-fluorobenzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 50mg.
2-cyano-3-fluorobenzoic acid (CAS 1214379-33-5) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 2-cyano-3-fluorobenzoic acid. InChIKey: LMZPDUDNUCZPQQ-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 2-cyano-3-fluorobenzoic acid |
| InChIKey | LMZPDUDNUCZPQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C#N)C(=O)O |
Computed by PubChem (NCBI)