CAS 94514-21-3 appears in our catalog under these names: 5-Fluoro-2H-isoindole-1,3-dione, 95%, 5-Fluoroisoindoline-1,3-dione, 98%, 5-Fluoro-2,3-dihydro-1H-isoindole-1,3-dione, 5-Fluoro-2,3-dihydro-1H-isoindole-1,3-dione, 98%, 98%, 5-FLUORO-2,3-DIHYDRO-1H-ISOINDOLE-1,3-DIONE, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 0,5g, 100mg, 250mg, 500mg, 2.5g.
5-fluoroisoindole-1,3-dione (CAS 94514-21-3) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 5-fluoroisoindole-1,3-dione. InChIKey: DVDRUQOUGHIYCB-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 5-fluoroisoindole-1,3-dione |
| InChIKey | DVDRUQOUGHIYCB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)NC2=O |
Computed by PubChem (NCBI)