cas: 175137-45-8 — see every product listed under this CAS number, including other names
3-Cyclopropyl-1-phenyl-1H-pyrazol-5-amine (CAS 175137-45-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 2.5g, 1g, 5g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | AHA13745-10g |
| cas | 175137-45-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 10g | price on request | |
| Fluorochem | 2.5g | 471.73 Pln | |
| Fluorochem | 10g | 1356.83 Pln | |
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 5g | 877.83 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
3-cyclopropyl-1-phenylpyrazol-5-amine (CAS 175137-45-8) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 3-cyclopropyl-1-phenylpyrazol-5-amine. InChIKey: MLOGPNMYHQADBA-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-cyclopropyl-1-phenylpyrazol-5-amine |
| InChIKey | MLOGPNMYHQADBA-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN(C(=C2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)