CAS 175137-45-8 appears in our catalog under these names: 3-Cyclopropyl-1-phenyl-1h-pyrazol-5-amine, 95%, 3-Cyclopropyl-1-phenyl-1H-pyrazol-5-amine. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 10g, 2.5g.
3-cyclopropyl-1-phenylpyrazol-5-amine (CAS 175137-45-8) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 3-cyclopropyl-1-phenylpyrazol-5-amine. InChIKey: MLOGPNMYHQADBA-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-cyclopropyl-1-phenylpyrazol-5-amine |
| InChIKey | MLOGPNMYHQADBA-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN(C(=C2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)