CAS 75115-28-5 appears in our catalog under these names: N3-Benzylpyridine-3,4-diamine, 95%, N3-Benzylpyridine-3,4-diamine 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
3-N-benzylpyridine-3,4-diamine (CAS 75115-28-5) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 3-N-benzylpyridine-3,4-diamine. InChIKey: SELGUEJXCMDJLV-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-N-benzylpyridine-3,4-diamine |
| InChIKey | SELGUEJXCMDJLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=CN=C2)N |
Computed by PubChem (NCBI)