CAS 537-65-5 appears in our catalog under these names: N1-(4-Aminophenyl)benzene-1,4-diamine, 98%, N1-(4-Aminophenyl)benzene-1,4-diamine, 95%, 95%, N1-(4-Aminophenyl)benzene-1,4-diamine, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g.
4-N-(4-aminophenyl)benzene-1,4-diamine (CAS 537-65-5) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 4-N-(4-aminophenyl)benzene-1,4-diamine. InChIKey: QZHXKQKKEBXYRG-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 4-N-(4-aminophenyl)benzene-1,4-diamine |
| InChIKey | QZHXKQKKEBXYRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)