cas: 342573-75-5 — see every product listed under this CAS number, including other names
3-Ethyl-1-methyl-1H-imidazol-3-ium ethyl sulfate, 98% (CAS 342573-75-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 250g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F791233-25G |
| cas | 342573-75-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 310.33 Pln | |
| Fluorochem | 250g | 518.59 Pln | |
| Fluorochem | 500g | 768.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-ethyl-3-methylimidazol-3-ium;ethyl sulfate (CAS 342573-75-5) is a chemical compound with the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium;ethyl sulfate. InChIKey: VRFOKYHDLYBVAL-UHFFFAOYSA-M.
| Molecular formula | C8H16N2O4S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium;ethyl sulfate |
| InChIKey | VRFOKYHDLYBVAL-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.CCOS(=O)(=O)[O-] |
Computed by PubChem (NCBI)