Products 1017381-49-5

CAS 1017381-49-5 is the registry number for 1-[(Dimethylamino)sulfonyl]piperidine-4-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

1-(dimethylsulfamoyl)piperidine-4-carboxylic acid (CAS 1017381-49-5) is a chemical compound with the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. IUPAC name: 1-(dimethylsulfamoyl)piperidine-4-carboxylic acid. InChIKey: QGIZIQMGNYFPQB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16N2O4S
Molecular weight236.29 g/mol
IUPAC name1-(dimethylsulfamoyl)piperidine-4-carboxylic acid
InChIKeyQGIZIQMGNYFPQB-UHFFFAOYSA-N
SMILESCN(C)S(=O)(=O)N1CCC(CC1)C(=O)O

Computed by PubChem (NCBI)