Products 1179080-56-8

CAS 1179080-56-8 is the registry number for 1-(N-Ethylsulfamoyl)piperidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(ethylsulfamoyl)piperidine-3-carboxylic acid (CAS 1179080-56-8) is a chemical compound with the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. IUPAC name: 1-(ethylsulfamoyl)piperidine-3-carboxylic acid. InChIKey: QLXOUMHKJWQACT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16N2O4S
Molecular weight236.29 g/mol
IUPAC name1-(ethylsulfamoyl)piperidine-3-carboxylic acid
InChIKeyQLXOUMHKJWQACT-UHFFFAOYSA-N
SMILESCCNS(=O)(=O)N1CCCC(C1)C(=O)O

Computed by PubChem (NCBI)