Products 2691835-55-7
CAS 2691835-55-7 is the registry number for tert-Butyl (E)-(3-sulfamoylallyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(E)-3-sulfamoylprop-2-enyl]carbamate (CAS 2691835-55-7) is a chemical compound with the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. IUPAC name: tert-butyl N-[(E)-3-sulfamoylprop-2-enyl]carbamate. InChIKey: PZRMJQKVHSKGHG-GQCTYLIASA-N.
| Molecular formula | C8H16N2O4S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | tert-butyl N-[(E)-3-sulfamoylprop-2-enyl]carbamate |
| InChIKey | PZRMJQKVHSKGHG-GQCTYLIASA-N |
| SMILES | CC(C)(C)OC(=O)NC/C=C/S(=O)(=O)N |
Computed by PubChem (NCBI)