CAS 1375338-65-0 is the registry number for tert-Butyl 1,2,5-thiadiazinane-5-carboxylate 1,1-dioxide, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl 1,1-dioxo-1,2,5-thiadiazinane-5-carboxylate (CAS 1375338-65-0) is a chemical compound with the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. IUPAC name: tert-butyl 1,1-dioxo-1,2,5-thiadiazinane-5-carboxylate. InChIKey: ICPXJPOBWGEBNQ-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O4S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | tert-butyl 1,1-dioxo-1,2,5-thiadiazinane-5-carboxylate |
| InChIKey | ICPXJPOBWGEBNQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNS(=O)(=O)C1 |
Computed by PubChem (NCBI)