CAS 952212-86-1 appears in our catalog under these names: tert-Butyl 1,2,6-thiadiazinane-2-carboxylate 1,1-dioxide, 95%, Tert-Butyl 1,2,6-Thiadiazinane-2-Carboxylate 1,1-Dioxide, tert-Butyl 1,2,6-thiadiazinane-2-carboxylate 1,1-dioxide, 97%, 97%, TERT-BUTYL 1,2,6-THIADIAZINANE-2-CARBOXYLATE 1,1-DIOXIDE, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 25g, 1g, 0,5g, 10g.
Tert-butyl 1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate (CAS 952212-86-1) is a chemical compound with the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. IUPAC name: tert-butyl 1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate. InChIKey: TZEXBPGMKLDBTM-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O4S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | tert-butyl 1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate |
| InChIKey | TZEXBPGMKLDBTM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCNS1(=O)=O |
Computed by PubChem (NCBI)