CAS 1909335-86-9 appears in our catalog under these names: tert-butyl 3-sulfamoylazetidine-1-carboxylate, 97%, tert-Butyl 3-sulfamoylazetidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
Tert-butyl 3-sulfamoylazetidine-1-carboxylate (CAS 1909335-86-9) is a chemical compound with the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. IUPAC name: tert-butyl 3-sulfamoylazetidine-1-carboxylate. InChIKey: YZLQZMKZXQYGOJ-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O4S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | tert-butyl 3-sulfamoylazetidine-1-carboxylate |
| InChIKey | YZLQZMKZXQYGOJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)S(=O)(=O)N |
Computed by PubChem (NCBI)