CAS 1017214-13-9 appears in our catalog under these names: 1-[(Dimethylamino)sulfonyl]piperidine-3-carboxylic acid, 98%, 1-((DImethylamino)sulfonyl)piperidine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.
1-(dimethylsulfamoyl)piperidine-3-carboxylic acid (CAS 1017214-13-9) is a chemical compound with the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. IUPAC name: 1-(dimethylsulfamoyl)piperidine-3-carboxylic acid. InChIKey: ZVVDFRDSNBLLIF-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O4S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 1-(dimethylsulfamoyl)piperidine-3-carboxylic acid |
| InChIKey | ZVVDFRDSNBLLIF-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1CCCC(C1)C(=O)O |
Computed by PubChem (NCBI)