cas: 1214335-98-4 — see every product listed under this CAS number, including other names
3-Fluoro-2-nitrobenzotrifluoride, 95%, 95% (CAS 1214335-98-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125U1-25g |
| cas | 1214335-98-4 |
| size | 25g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 6390.80 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1413.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-fluoro-2-nitro-3-(trifluoromethyl)benzene (CAS 1214335-98-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-fluoro-2-nitro-3-(trifluoromethyl)benzene. InChIKey: GZNQDXJGTLXDGN-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-fluoro-2-nitro-3-(trifluoromethyl)benzene |
| InChIKey | GZNQDXJGTLXDGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)