cas: 1214335-98-4 — see every product listed under this CAS number, including other names
3-Fluoro-2-nitrobenzotrifluoride, 97% (CAS 1214335-98-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091202-250MG |
| cas | 1214335-98-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 2132.60 Pln | |
| Fluorochem | 25g | 8291.89 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-fluoro-2-nitro-3-(trifluoromethyl)benzene (CAS 1214335-98-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-fluoro-2-nitro-3-(trifluoromethyl)benzene. InChIKey: GZNQDXJGTLXDGN-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-fluoro-2-nitro-3-(trifluoromethyl)benzene |
| InChIKey | GZNQDXJGTLXDGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)