cas: 886510-09-4 — see every product listed under this CAS number, including other names
3-Fluoro-2-trifluoromethyl-isonicotinic acid, 97% (CAS 886510-09-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032498-250MG |
| cas | 886510-09-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 1096.51 Pln | |
| Fluorochem | 10g | 1705.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 886510-09-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: GOYPFNAZTPCXGS-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | GOYPFNAZTPCXGS-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)F)C(F)(F)F |
Computed by PubChem (NCBI)