cas: 886510-09-4 — see every product listed under this CAS number, including other names
3-fluoro(trifluoromethyl)isonicotinic acid, 98%, 98% (CAS 886510-09-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11401P-100mg |
| cas | 886510-09-4 |
| size | 100mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 568.40 Pln | |
| Chemat | 10g | 870.80 Pln | |
| Chemat | 25g | 1907.60 Pln | |
| Chemat | 500mg | 174.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 886510-09-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: GOYPFNAZTPCXGS-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | GOYPFNAZTPCXGS-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)F)C(F)(F)F |
Computed by PubChem (NCBI)