cas: 454-73-9 — see every product listed under this CAS number, including other names
3-Fluoro-4-iodotoluene 98% (CAS 454-73-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A198580-250mg |
| cas | 454-73-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 392.62 Pln | |
| Ambeed | 25g | 876.56 Pln | |
| Ambeed | 100g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A198580 |
1-fluoro-3-nitro-5-(trifluoromethyl)benzene (CAS 454-73-9) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-fluoro-3-nitro-5-(trifluoromethyl)benzene. InChIKey: RKLBCPTURHSIOJ-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-fluoro-3-nitro-5-(trifluoromethyl)benzene |
| InChIKey | RKLBCPTURHSIOJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])F)C(F)(F)F |
Computed by PubChem (NCBI)