3-Fluoro-4-nitrophenol 97%
cas: 394-41-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-nitrophenol 97% (CAS 394-41-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A259356-1g |
| cas | 394-41-2 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 804.25 Pln | |
| Ambeed | 500g | 3001.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A259356 |
3-fluoro-4-nitrophenol (CAS 394-41-2) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 3-fluoro-4-nitrophenol. InChIKey: CSSGKHVRDGATJL-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 3-fluoro-4-nitrophenol |
| InChIKey | CSSGKHVRDGATJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)