cas: 394-41-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-nitrophenol, >98.0%(GC) (CAS 394-41-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0348-5G |
| cas | 394-41-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 669.08 Pln | |
| TCI | 25g | 2537.63 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
3-fluoro-4-nitrophenol (CAS 394-41-2) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 3-fluoro-4-nitrophenol. InChIKey: CSSGKHVRDGATJL-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 3-fluoro-4-nitrophenol |
| InChIKey | CSSGKHVRDGATJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)