3-Fluoro-4-nitrophenol, 98%, 98%
cas: 394-41-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-nitrophenol, 98%, 98% (CAS 394-41-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXD3-1g |
| cas | 394-41-2 |
| size | 1g |
| availability | 5000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 246.80 Pln | |
| Chemat | 50g | 386.00 Pln | |
| Chemat | 100g | 611.60 Pln | |
| Chemat | 250g | 1370.00 Pln | |
| Chemat | 500g | 2611.20 Pln | |
| Chemat | 1kg | 3126.80 Pln | |
| Chemat | 5kg | 14496.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-fluoro-4-nitrophenol (CAS 394-41-2) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 3-fluoro-4-nitrophenol. InChIKey: CSSGKHVRDGATJL-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 3-fluoro-4-nitrophenol |
| InChIKey | CSSGKHVRDGATJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)