cas: 394-41-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-nitrophenol, 95% (CAS 394-41-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F001469-1G |
| cas | 394-41-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 100g | 784.12 Pln | |
| Fluorochem | 500g | 2923.99 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-fluoro-4-nitrophenol (CAS 394-41-2) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 3-fluoro-4-nitrophenol. InChIKey: CSSGKHVRDGATJL-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 3-fluoro-4-nitrophenol |
| InChIKey | CSSGKHVRDGATJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)