Products 394-41-2
CAS 394-41-2 appears in our catalog under these names: 3-Fluoro-4-nitrophenol, 98%, 93 Sorafenib Impurity 93, 3–Fluoro–4–nitrophenol, 3-Fluoro-4-nitrophenol/ 99%, 3-Fluoro-4-nitrophenol, 99% . Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 100g, 5g, 1g, on request, 10g, 500g, 50g.
3-fluoro-4-nitrophenol (CAS 394-41-2) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 3-fluoro-4-nitrophenol. InChIKey: CSSGKHVRDGATJL-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 3-fluoro-4-nitrophenol |
| InChIKey | CSSGKHVRDGATJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)